cas: 72830-07-0 — see every product listed under this CAS number, including other names
3,4-Dimethoxy-2-methylpyridine 1-oxide 95% (CAS 72830-07-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A981932-250mg |
| cas | 72830-07-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1744.31 Pln | |
| Ambeed | 25g | 5699.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A981932 |
3,4-dimethoxy-2-methyl-1-oxidopyridin-1-ium (CAS 72830-07-0) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. IUPAC name: 3,4-dimethoxy-2-methyl-1-oxidopyridin-1-ium. InChIKey: UMVFRRJTPKYVAY-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 3,4-dimethoxy-2-methyl-1-oxidopyridin-1-ium |
| InChIKey | UMVFRRJTPKYVAY-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=CC(=C1OC)OC)[O-] |
Computed by PubChem (NCBI)