cas: 709-09-1 — see every product listed under this CAS number, including other names
3,4-Dimethoxynitrobenzene, 98% (CAS 709-09-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209901-5G |
| cas | 709-09-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 100g | 221.81 Pln | |
| Fluorochem | 500g | 565.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1,2-dimethoxy-4-nitrobenzene (CAS 709-09-1) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 1,2-dimethoxy-4-nitrobenzene. InChIKey: YFWBUVZWCBFSQN-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 1,2-dimethoxy-4-nitrobenzene |
| InChIKey | YFWBUVZWCBFSQN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)