cas: 82428-30-6 — see every product listed under this CAS number, including other names
3,4-Epoxycyclohexylmethyl methacrylate, 97%, 97% (CAS 82428-30-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119JZE-5g |
| cas | 82428-30-6 |
| size | 5g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 141.20 Pln | |
| Chemat | 500g | 528.00 Pln | |
| Chemat | 1kg | 861.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate (CAS 82428-30-6) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: [(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate. InChIKey: FYYIUODUDSPAJQ-XVBQNVSMSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | [(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate |
| InChIKey | FYYIUODUDSPAJQ-XVBQNVSMSA-N |
| SMILES | CC(=C)C(=O)OCC1CC[C@@H]2[C@H](C1)O2 |
Computed by PubChem (NCBI)