cas: 82428-30-6 — see every product listed under this CAS number, including other names
7-Oxabicyclo[4.1.0]heptan-3-ylmethyl methacrylate 95% (CAS 82428-30-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A407103-25g |
| cas | 82428-30-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 142.31 Pln | |
| Ambeed | 100g | 298.06 Pln | |
| Ambeed | 500g | 798.69 Pln | |
| Ambeed | 1000g | 1438.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A407103 |
[(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate (CAS 82428-30-6) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: [(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate. InChIKey: FYYIUODUDSPAJQ-XVBQNVSMSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | [(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate |
| InChIKey | FYYIUODUDSPAJQ-XVBQNVSMSA-N |
| SMILES | CC(=C)C(=O)OCC1CC[C@@H]2[C@H](C1)O2 |
Computed by PubChem (NCBI)