cas: 2620-44-2 — see every product listed under this CAS number, including other names
3,4-Methylenedioxynitrobenzene, >98.0%(GC) (CAS 2620-44-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M0848-5G |
| cas | 2620-44-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 147.85 Pln | |
| TCI | 25g | 413.38 Pln | |
| TCI | 500g | 3511.25 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
5-nitro-1,3-benzodioxole (CAS 2620-44-2) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. IUPAC name: 5-nitro-1,3-benzodioxole. InChIKey: SNWQAKNKGGOVMO-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 5-nitro-1,3-benzodioxole |
| InChIKey | SNWQAKNKGGOVMO-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)