cas: 2620-44-2 — see every product listed under this CAS number, including other names
5-Nitrobenzo[d][1,3]dioxole, 98% (CAS 2620-44-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F220387-1G |
| cas | 2620-44-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 100g | 263.47 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-nitro-1,3-benzodioxole (CAS 2620-44-2) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. IUPAC name: 5-nitro-1,3-benzodioxole. InChIKey: SNWQAKNKGGOVMO-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 5-nitro-1,3-benzodioxole |
| InChIKey | SNWQAKNKGGOVMO-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)