cas: 163452-78-6 — see every product listed under this CAS number, including other names
3,4-Pyridinediamine, 5-bromo-2-chloro-, 97%, 97% (CAS 163452-78-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112U52-250mg |
| cas | 163452-78-6 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 333.20 Pln | |
| Chemat | 25g | 664.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-chloropyridine-3,4-diamine (CAS 163452-78-6) is a chemical compound with the molecular formula C5H5BrClN3 and a molecular weight of 222.47 g/mol. IUPAC name: 5-bromo-2-chloropyridine-3,4-diamine. InChIKey: IFEZDSVRWYQAJR-UHFFFAOYSA-N.
| Molecular formula | C5H5BrClN3 |
|---|---|
| Molecular weight | 222.47 g/mol |
| IUPAC name | 5-bromo-2-chloropyridine-3,4-diamine |
| InChIKey | IFEZDSVRWYQAJR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)N)N)Br |
Computed by PubChem (NCBI)