cas: 163452-78-6 — see every product listed under this CAS number, including other names
5-Bromo-2-chloropyridine-3,4-diamine, 97% (CAS 163452-78-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217682-1G |
| cas | 163452-78-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 10g | 388.42 Pln | |
| Fluorochem | 25g | 794.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-2-chloropyridine-3,4-diamine (CAS 163452-78-6) is a chemical compound with the molecular formula C5H5BrClN3 and a molecular weight of 222.47 g/mol. IUPAC name: 5-bromo-2-chloropyridine-3,4-diamine. InChIKey: IFEZDSVRWYQAJR-UHFFFAOYSA-N.
| Molecular formula | C5H5BrClN3 |
|---|---|
| Molecular weight | 222.47 g/mol |
| IUPAC name | 5-bromo-2-chloropyridine-3,4-diamine |
| InChIKey | IFEZDSVRWYQAJR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)N)N)Br |
Computed by PubChem (NCBI)