cas: 85068-29-7 — see every product listed under this CAS number, including other names
3,5-Bis(trifluoromethyl)benzylamine 97% (CAS 85068-29-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A118067-1g |
| cas | 85068-29-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 320.31 Pln | |
| Ambeed | 100g | 1065.69 Pln | |
| Ambeed | 500g | 4052.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A118067 |
[3,5-bis(trifluoromethyl)phenyl]methanamine (CAS 85068-29-7) is a chemical compound with the molecular formula C9H7F6N and a molecular weight of 243.15 g/mol. IUPAC name: [3,5-bis(trifluoromethyl)phenyl]methanamine. InChIKey: DHVHORCFFOSRBP-UHFFFAOYSA-N.
| Molecular formula | C9H7F6N |
|---|---|
| Molecular weight | 243.15 g/mol |
| IUPAC name | [3,5-bis(trifluoromethyl)phenyl]methanamine |
| InChIKey | DHVHORCFFOSRBP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CN |
Computed by PubChem (NCBI)