cas: 85068-29-7 — see every product listed under this CAS number, including other names
3,5-Bis(trifluoromethyl)benzylamine, 85% (CAS 85068-29-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006021-1G |
| cas | 85068-29-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 206.20 Pln | |
| Fluorochem | 25g | 409.25 Pln | |
| Fluorochem | 100g | 1018.41 Pln |
| purity | 85% |
|---|---|
| delivery time | 2-3 weeks |
[3,5-bis(trifluoromethyl)phenyl]methanamine (CAS 85068-29-7) is a chemical compound with the molecular formula C9H7F6N and a molecular weight of 243.15 g/mol. IUPAC name: [3,5-bis(trifluoromethyl)phenyl]methanamine. InChIKey: DHVHORCFFOSRBP-UHFFFAOYSA-N.
| Molecular formula | C9H7F6N |
|---|---|
| Molecular weight | 243.15 g/mol |
| IUPAC name | [3,5-bis(trifluoromethyl)phenyl]methanamine |
| InChIKey | DHVHORCFFOSRBP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CN |
Computed by PubChem (NCBI)