cas: 51707-38-1 — see every product listed under this CAS number, including other names
3,5-DIMETHOXYBENZHYDRAZIDE, 98%, 98% (CAS 51707-38-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I09T-1g |
| cas | 51707-38-1 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 314.00 Pln | |
| Chemat | 10g | 362.00 Pln | |
| Chemat | 25g | 818.00 Pln | |
| Chemat | 100g | 3050.00 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-dimethoxybenzohydrazide (CAS 51707-38-1) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 3,5-dimethoxybenzohydrazide. InChIKey: DOWVACHORBOSEF-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3,5-dimethoxybenzohydrazide |
| InChIKey | DOWVACHORBOSEF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)NN)OC |
Computed by PubChem (NCBI)