cas: 16727-44-9 — see every product listed under this CAS number, including other names
3,5-Dibromo-2,6-dimethoxypyridine 98% (CAS 16727-44-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A436821-100mg |
| cas | 16727-44-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A436821 |
3,5-dibromo-2,6-dimethoxypyridine (CAS 16727-44-9) is a chemical compound with the molecular formula C7H7Br2NO2 and a molecular weight of 296.94 g/mol. IUPAC name: 3,5-dibromo-2,6-dimethoxypyridine. InChIKey: SQWUBNSHUMRETN-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2NO2 |
|---|---|
| Molecular weight | 296.94 g/mol |
| IUPAC name | 3,5-dibromo-2,6-dimethoxypyridine |
| InChIKey | SQWUBNSHUMRETN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)Br)Br |
Computed by PubChem (NCBI)