Products 861018-86-2
CAS 861018-86-2 appears in our catalog under these names: 3,5-Dibromopyridine-2-carboxamide, 3,5-Dibromopicolinamide, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
3,5-dibromopyridine-2-carboxamide (CAS 861018-86-2) is a chemical compound with the molecular formula C6H4Br2N2O and a molecular weight of 279.92 g/mol. IUPAC name: 3,5-dibromopyridine-2-carboxamide. InChIKey: YLBBGQQDRRAVHJ-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O |
|---|---|
| Molecular weight | 279.92 g/mol |
| IUPAC name | 3,5-dibromopyridine-2-carboxamide |
| InChIKey | YLBBGQQDRRAVHJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)C(=O)N)Br |
Computed by PubChem (NCBI)