Products 2639837-08-2

CAS 2639837-08-2 is the registry number for 2,3-dibromo-5,6-dihydropyrrolo[1,2-a]imidazol-7-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2,3-dibromo-5,6-dihydropyrrolo[1,2-a]imidazol-7-one (CAS 2639837-08-2) is a chemical compound with the molecular formula C6H4Br2N2O and a molecular weight of 279.92 g/mol. IUPAC name: 2,3-dibromo-5,6-dihydropyrrolo[1,2-a]imidazol-7-one. InChIKey: WWFFYLACWWPETK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4Br2N2O
Molecular weight279.92 g/mol
IUPAC name2,3-dibromo-5,6-dihydropyrrolo[1,2-a]imidazol-7-one
InChIKeyWWFFYLACWWPETK-UHFFFAOYSA-N
SMILESC1CN2C(=C(N=C2C1=O)Br)Br

Computed by PubChem (NCBI)