CAS 1379303-54-4 appears in our catalog under these names: 2,6-Dibromopyridine-3-carboxamide, 96%, 2,6-Dibromonicotinamide, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2,6-dibromopyridine-3-carboxamide (CAS 1379303-54-4) is a chemical compound with the molecular formula C6H4Br2N2O and a molecular weight of 279.92 g/mol. IUPAC name: 2,6-dibromopyridine-3-carboxamide. InChIKey: HOEIBCGSMFYTCT-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O |
|---|---|
| Molecular weight | 279.92 g/mol |
| IUPAC name | 2,6-dibromopyridine-3-carboxamide |
| InChIKey | HOEIBCGSMFYTCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)N)Br)Br |
Computed by PubChem (NCBI)