Products 1451390-73-0
CAS 1451390-73-0 is the registry number for 2,2-Dibromo-1-(pyrimidin-2-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-pyrimidin-2-ylethanone (CAS 1451390-73-0) is a chemical compound with the molecular formula C6H4Br2N2O and a molecular weight of 279.92 g/mol. IUPAC name: 2,2-dibromo-1-pyrimidin-2-ylethanone. InChIKey: LFUODLNWIVFNLQ-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O |
|---|---|
| Molecular weight | 279.92 g/mol |
| IUPAC name | 2,2-dibromo-1-pyrimidin-2-ylethanone |
| InChIKey | LFUODLNWIVFNLQ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)C(=O)C(Br)Br |
Computed by PubChem (NCBI)