cas: 83121-15-7 — see every product listed under this CAS number, including other names
3,5-Dichloro-2,4-difluoroaniline, >94.0%(GC) (CAS 83121-15-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3637-5G |
| cas | 83121-15-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 162.60 Pln | |
| TCI | 25g | 472.39 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >94.0%(GC) |
3,5-dichloro-2,4-difluoroaniline (CAS 83121-15-7) is a chemical compound with the molecular formula C6H3Cl2F2N and a molecular weight of 197.99 g/mol. IUPAC name: 3,5-dichloro-2,4-difluoroaniline. InChIKey: KLECNQGLBJHVSH-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F2N |
|---|---|
| Molecular weight | 197.99 g/mol |
| IUPAC name | 3,5-dichloro-2,4-difluoroaniline |
| InChIKey | KLECNQGLBJHVSH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)F)Cl)F)N |
Computed by PubChem (NCBI)