cas: 1374659-33-2 — see every product listed under this CAS number, including other names
3,5-Dichloro-4-(difluoromethyl)pyridine (CAS 1374659-33-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050449-1G |
| cas | 1374659-33-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1231.88 Pln |
| delivery time | 2-3 weeks |
|---|
3,5-dichloro-4-(difluoromethyl)pyridine (CAS 1374659-33-2) is a chemical compound with the molecular formula C6H3Cl2F2N and a molecular weight of 197.99 g/mol. IUPAC name: 3,5-dichloro-4-(difluoromethyl)pyridine. InChIKey: SQQNYQZGLSIAIG-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F2N |
|---|---|
| Molecular weight | 197.99 g/mol |
| IUPAC name | 3,5-dichloro-4-(difluoromethyl)pyridine |
| InChIKey | SQQNYQZGLSIAIG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)C(F)F)Cl |
Computed by PubChem (NCBI)