cas: 103879-31-8 — see every product listed under this CAS number, including other names
3,5-Dichloro-4-fluorobenzonitrile 97% (CAS 103879-31-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A146841-250mg |
| cas | 103879-31-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 10g | 381.50 Pln | |
| Ambeed | 25g | 832.06 Pln | |
| Ambeed | 100g | 2895.75 Pln | |
| Ambeed | 500g | 11384.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A146841 |
3,5-dichloro-4-fluorobenzonitrile (CAS 103879-31-8) is a chemical compound with the molecular formula C7H2Cl2FN and a molecular weight of 190.00 g/mol. IUPAC name: 3,5-dichloro-4-fluorobenzonitrile. InChIKey: RIOPZMHLYZUNFX-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FN |
|---|---|
| Molecular weight | 190.00 g/mol |
| IUPAC name | 3,5-dichloro-4-fluorobenzonitrile |
| InChIKey | RIOPZMHLYZUNFX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)F)Cl)C#N |
Computed by PubChem (NCBI)