CAS 313340-08-8 appears in our catalog under these names: 3,5-Dichloro-6-ethylpyrazine-2-carboxamide, 98%, 98%, 3,5-Dichloro-6-ethylpyrazine-2-carboxamide, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
3,5-dichloro-6-ethylpyrazine-2-carboxamide (CAS 313340-08-8) is a chemical compound with the molecular formula C7H7Cl2N3O and a molecular weight of 220.05 g/mol. IUPAC name: 3,5-dichloro-6-ethylpyrazine-2-carboxamide. InChIKey: KMIXLCQPYRNBEH-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3O |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 3,5-dichloro-6-ethylpyrazine-2-carboxamide |
| InChIKey | KMIXLCQPYRNBEH-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(C(=N1)C(=O)N)Cl)Cl |
Computed by PubChem (NCBI)