CAS 732223-04-0 is the registry number for N-(2,4-Dichlorophenyl)hydrazinecarboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 10g.
1-amino-3-(2,4-dichlorophenyl)urea (CAS 732223-04-0) is a chemical compound with the molecular formula C7H7Cl2N3O and a molecular weight of 220.05 g/mol. IUPAC name: 1-amino-3-(2,4-dichlorophenyl)urea. InChIKey: UQRODDZHYZHAKL-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3O |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 1-amino-3-(2,4-dichlorophenyl)urea |
| InChIKey | UQRODDZHYZHAKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)NC(=O)NN |
Computed by PubChem (NCBI)