CAS 66999-54-0 is the registry number for 2-Chloro-n'-(6-chloropyridin-2-yl)acetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-N'-(6-chloro-2-pyridinyl)acetohydrazide (CAS 66999-54-0) is a chemical compound with the molecular formula C7H7Cl2N3O and a molecular weight of 220.05 g/mol. IUPAC name: 2-chloro-N'-(6-chloro-2-pyridinyl)acetohydrazide. InChIKey: JOUNKUKGGKLEGV-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3O |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 2-chloro-N'-(6-chloro-2-pyridinyl)acetohydrazide |
| InChIKey | JOUNKUKGGKLEGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)NNC(=O)CCl |
Computed by PubChem (NCBI)