CAS 84066-19-3 is the registry number for 1-((3,5-Dichloropyrazin-2-yl)amino)propan-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(3,5-dichloropyrazin-2-yl)amino]propan-2-one (CAS 84066-19-3) is a chemical compound with the molecular formula C7H7Cl2N3O and a molecular weight of 220.05 g/mol. IUPAC name: 1-[(3,5-dichloropyrazin-2-yl)amino]propan-2-one. InChIKey: UDRWMCBPJJGVHG-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3O |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 1-[(3,5-dichloropyrazin-2-yl)amino]propan-2-one |
| InChIKey | UDRWMCBPJJGVHG-UHFFFAOYSA-N |
| SMILES | CC(=O)CNC1=NC=C(N=C1Cl)Cl |
Computed by PubChem (NCBI)