3,5-Dichloro-6-iodopyrazolo[1,5-a]pyrimidine, 95%
cas: 2640353-16-6 — see every product listed under this CAS number, including other names
3,5-Dichloro-6-iodopyrazolo[1,5-a]pyrimidine, 95% (CAS 2640353-16-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1643918-100mg |
| cas | 2640353-16-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1610.81 Pln | |
| Ambeed | 5g | 4720.25 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1730.53 Pln | |
| BLDpharm | 5g | 5084.90 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3,5-dichloro-6-iodopyrazolo[1,5-a]pyrimidine (CAS 2640353-16-6) is a chemical compound with the molecular formula C6H2Cl2IN3 and a molecular weight of 313.91 g/mol. IUPAC name: 3,5-dichloro-6-iodopyrazolo[1,5-a]pyrimidine. InChIKey: HGSURTLFDXBZGO-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2IN3 |
|---|---|
| Molecular weight | 313.91 g/mol |
| IUPAC name | 3,5-dichloro-6-iodopyrazolo[1,5-a]pyrimidine |
| InChIKey | HGSURTLFDXBZGO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC2=C(C=NN21)Cl)Cl)I |
Computed by PubChem (NCBI)