Products 51719-65-4
CAS 51719-65-4 appears in our catalog under these names: 2–(3，5–dichlorophenyl)acetic acid, 3,5-Dichlorophenylacetic acid, 95% , 2-(3,5-Dichlorophenyl)acetic acid 97%, 2-(3,5-dichlorophenyl)acetic acid, 97%, 97%, 2-(3,5-Dichlorophenyl)acetic acid, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g, 1000g, 50g.
2-(3,5-dichlorophenyl)acetic acid (CAS 51719-65-4) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)acetic acid. InChIKey: RERINLRFXYGZEE-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)acetic acid |
| InChIKey | RERINLRFXYGZEE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)