cas: 122129-79-7 — see every product listed under this CAS number, including other names
3,5-Difluoro-4-nitroaniline 98% (CAS 122129-79-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A321790-100mg |
| cas | 122129-79-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 442.69 Pln | |
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 1460.62 Pln | |
| Ambeed | 5g | 5270.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A321790 |
3,5-difluoro-4-nitroaniline (CAS 122129-79-7) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 3,5-difluoro-4-nitroaniline. InChIKey: RKBPGWQSTWNFRY-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 3,5-difluoro-4-nitroaniline |
| InChIKey | RKBPGWQSTWNFRY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)N |
Computed by PubChem (NCBI)