3,5-Difluoro-4-nitrobenzonitrile, 96%
cas: 1123172-88-2 — see every product listed under this CAS number, including other names
3,5-Difluoro-4-nitrobenzonitrile, 96% (CAS 1123172-88-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch119XKU-100mg |
| cas | 1123172-88-2 |
| size | 100mg |
| availability | 140g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 261.20 Pln | |
| Chemat | 10g | 458.00 Pln | |
| Chemat | 25g | 971.60 Pln | |
| Chemat | 100g | 3112.40 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 310.32 Pln | |
| Fluorochem | 10g | 549.82 Pln | |
| Fluorochem | 25g | 1247.50 Pln | |
| Fluorochem | 100g | 4454.70 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3,5-difluoro-4-nitrobenzonitrile (CAS 1123172-88-2) is a chemical compound with the molecular formula C7H2F2N2O2 and a molecular weight of 184.10 g/mol. IUPAC name: 3,5-difluoro-4-nitrobenzonitrile. InChIKey: NZIZYTSUHGNYMD-UHFFFAOYSA-N.
| Molecular formula | C7H2F2N2O2 |
|---|---|
| Molecular weight | 184.10 g/mol |
| IUPAC name | 3,5-difluoro-4-nitrobenzonitrile |
| InChIKey | NZIZYTSUHGNYMD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)C#N |
Computed by PubChem (NCBI)