CAS 1247885-40-0 appears in our catalog under these names: 2,3–Difluoro–5–nitrobenzonitrile, 2,3-Difluoro-5-nitrobenzonitrile, 95%, 95%, 2,3-Difluoro-5-nitrobenzonitrile, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,3-difluoro-5-nitrobenzonitrile (CAS 1247885-40-0) is a chemical compound with the molecular formula C7H2F2N2O2 and a molecular weight of 184.10 g/mol. IUPAC name: 2,3-difluoro-5-nitrobenzonitrile. InChIKey: SREQFLXKAOEIEW-UHFFFAOYSA-N.
| Molecular formula | C7H2F2N2O2 |
|---|---|
| Molecular weight | 184.10 g/mol |
| IUPAC name | 2,3-difluoro-5-nitrobenzonitrile |
| InChIKey | SREQFLXKAOEIEW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)