CAS 1803870-92-9 is the registry number for 2,3-difluoro-4-nitrobenzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,3-difluoro-4-nitrobenzonitrile (CAS 1803870-92-9) is a chemical compound with the molecular formula C7H2F2N2O2 and a molecular weight of 184.10 g/mol. IUPAC name: 2,3-difluoro-4-nitrobenzonitrile. InChIKey: DDLKRJIMXDYNMN-UHFFFAOYSA-N.
| Molecular formula | C7H2F2N2O2 |
|---|---|
| Molecular weight | 184.10 g/mol |
| IUPAC name | 2,3-difluoro-4-nitrobenzonitrile |
| InChIKey | DDLKRJIMXDYNMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)