CAS 1186194-75-1 appears in our catalog under these names: 2,4-Difluoro-3-nitrobenzonitrile, 98%, 2,4-Difluoro-3-nitrobenzonitrile, 97%, 2,4-Difluoro-3-nitrobenzonitrile 98%. Offered by: Combi-blocks, Thermo Scientific (Acros), Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100mg.
2,4-difluoro-3-nitrobenzonitrile (CAS 1186194-75-1) is a chemical compound with the molecular formula C7H2F2N2O2 and a molecular weight of 184.10 g/mol. IUPAC name: 2,4-difluoro-3-nitrobenzonitrile. InChIKey: HESWWHRCQMLPFT-UHFFFAOYSA-N.
| Molecular formula | C7H2F2N2O2 |
|---|---|
| Molecular weight | 184.10 g/mol |
| IUPAC name | 2,4-difluoro-3-nitrobenzonitrile |
| InChIKey | HESWWHRCQMLPFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)