cas: 842140-51-6 — see every product listed under this CAS number, including other names
3,5-Difluorobenzoylacetonitrile, 97% (CAS 842140-51-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F022383-50MG |
| cas | 842140-51-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 419.66 Pln | |
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 659.16 Pln | |
| Fluorochem | 500mg | 1252.70 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(3,5-difluorophenyl)-3-oxopropanenitrile (CAS 842140-51-6) is a chemical compound with the molecular formula C9H5F2NO and a molecular weight of 181.14 g/mol. IUPAC name: 3-(3,5-difluorophenyl)-3-oxopropanenitrile. InChIKey: YNNWBLSXFFMWQX-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO |
|---|---|
| Molecular weight | 181.14 g/mol |
| IUPAC name | 3-(3,5-difluorophenyl)-3-oxopropanenitrile |
| InChIKey | YNNWBLSXFFMWQX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(=O)CC#N |
Computed by PubChem (NCBI)