Products 2004718-99-2
CAS 2004718-99-2 appears in our catalog under these names: 5-(2,5-Difluorophenyl)-1,3-oxazole, 95%, 5-(2,5-Difluorophenyl)-1,3-oxazole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
5-(2,5-difluorophenyl)-1,3-oxazole (CAS 2004718-99-2) is a chemical compound with the molecular formula C9H5F2NO and a molecular weight of 181.14 g/mol. IUPAC name: 5-(2,5-difluorophenyl)-1,3-oxazole. InChIKey: PBXCUZNWELCNAH-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO |
|---|---|
| Molecular weight | 181.14 g/mol |
| IUPAC name | 5-(2,5-difluorophenyl)-1,3-oxazole |
| InChIKey | PBXCUZNWELCNAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C2=CN=CO2)F |
Computed by PubChem (NCBI)