CAS 874781-10-9 appears in our catalog under these names: 5,8-Difluoro-4-hydroxyquinoline, 95%, 5,8-Difluoro-4-hydroxyquinoline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g.
5,8-difluoro-1H-quinolin-4-one (CAS 874781-10-9) is a chemical compound with the molecular formula C9H5F2NO and a molecular weight of 181.14 g/mol. IUPAC name: 5,8-difluoro-1H-quinolin-4-one. InChIKey: YQQXQAYFERRWTG-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO |
|---|---|
| Molecular weight | 181.14 g/mol |
| IUPAC name | 5,8-difluoro-1H-quinolin-4-one |
| InChIKey | YQQXQAYFERRWTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)C(=O)C=CN2)F |
Computed by PubChem (NCBI)