CAS 260267-07-0 appears in our catalog under these names: 5,6-Difluoro-1h-indole-3-carbaldehyde, 95%, 5,6-Difluoro-1H-indole-3-carbaldehyde 98%, 5,6-Difluoro-1H-indole-3-carbaldehyde, 98%, 98%, 5,6-Difluoro-1H-indole-3-carbaldehyde, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5,6-difluoro-1H-indole-3-carbaldehyde (CAS 260267-07-0) is a chemical compound with the molecular formula C9H5F2NO and a molecular weight of 181.14 g/mol. IUPAC name: 5,6-difluoro-1H-indole-3-carbaldehyde. InChIKey: JVFNNILBFBSJLA-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO |
|---|---|
| Molecular weight | 181.14 g/mol |
| IUPAC name | 5,6-difluoro-1H-indole-3-carbaldehyde |
| InChIKey | JVFNNILBFBSJLA-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NC=C2C=O |
Computed by PubChem (NCBI)