cas: 903522-29-2 — see every product listed under this CAS number, including other names
3,5-Difluoroisonicotinic acid, 97%, 97% (CAS 903522-29-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144JD-250mg |
| cas | 903522-29-2 |
| size | 250mg |
| availability | 18g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 342.80 Pln | |
| Chemat | 10g | 563.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,5-difluoropyridine-4-carboxylic acid (CAS 903522-29-2) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 3,5-difluoropyridine-4-carboxylic acid. InChIKey: DRWDDFVJHGAJTN-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 3,5-difluoropyridine-4-carboxylic acid |
| InChIKey | DRWDDFVJHGAJTN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)F)C(=O)O)F |
Computed by PubChem (NCBI)