Products 851386-39-5

CAS 851386-39-5 appears in our catalog under these names: 2,5-Difluoropyridine-4-carboxylic acid, 97%, 2,5-Difluoroisonicotinic acid 95+%, 2,5-Difluoroisonicotinic acid, 95+%, 95+%, 2,5-Difluoropyridine-4-carboxylic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg, 10g.

Structural formula: {0} (CAS {1})

2,5-difluoropyridine-4-carboxylic acid (CAS 851386-39-5) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 2,5-difluoropyridine-4-carboxylic acid. InChIKey: ZOWKELQABLPUIR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3F2NO2
Molecular weight159.09 g/mol
IUPAC name2,5-difluoropyridine-4-carboxylic acid
InChIKeyZOWKELQABLPUIR-UHFFFAOYSA-N
SMILESC1=C(C(=CN=C1F)F)C(=O)O

Computed by PubChem (NCBI)