CAS 446-35-5 appears in our catalog under these names: 2,4-Difluoronitrobenzene, 98%, Flurbiprofen Impurity 46, 2,4-Difluoronitrobenzene, 2,4–Difluoronitrobenzene, 2,4-Difluoro-1-nitrobenzene, 98% . Offered by: Combi-blocks, Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100g, 1kg, 25g, 5g, 500g, on request, 2.5kg.
2,4-difluoro-1-nitrobenzene (CAS 446-35-5) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 2,4-difluoro-1-nitrobenzene. InChIKey: RJXOVESYJFXCGI-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 2,4-difluoro-1-nitrobenzene |
| InChIKey | RJXOVESYJFXCGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)