CAS 903522-29-2 appears in our catalog under these names: 3,5-Difluoroisonicotinic acid 97%, 3,5-Difluoroisonicotinic acid, 97%, 97%, 3,5-Difluoropyridine-4-carboxylic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg.
3,5-difluoropyridine-4-carboxylic acid (CAS 903522-29-2) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 3,5-difluoropyridine-4-carboxylic acid. InChIKey: DRWDDFVJHGAJTN-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 3,5-difluoropyridine-4-carboxylic acid |
| InChIKey | DRWDDFVJHGAJTN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)F)C(=O)O)F |
Computed by PubChem (NCBI)