cas: 1342464-27-0 — see every product listed under this CAS number, including other names
3,5-Dimethyl-1-(tetrahydro-2H-pyran-4-yl)-1H-pyrazole-4-carboxylic acid, 97% (CAS 1342464-27-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A164109-5g |
| cas | 1342464-27-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 32268.46 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,5-dimethyl-1-(oxan-4-yl)pyrazole-4-carboxylic acid (CAS 1342464-27-0) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: 3,5-dimethyl-1-(oxan-4-yl)pyrazole-4-carboxylic acid. InChIKey: OXLQZJMKYWSCAN-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 3,5-dimethyl-1-(oxan-4-yl)pyrazole-4-carboxylic acid |
| InChIKey | OXLQZJMKYWSCAN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2CCOCC2)C)C(=O)O |
Computed by PubChem (NCBI)