cas: 2096333-27-4 — see every product listed under this CAS number, including other names
3,5-Dimethyl-4-methoxycarbonylphenylboronic acid, pinacol ester, 97%, 97% (CAS 2096333-27-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHDT-10g |
| cas | 2096333-27-4 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 3294.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 515.60 Pln | |
| Chemat | 5g | 1878.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2096333-27-4) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: methyl 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: VDELJAWMMVSPIE-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | methyl 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | VDELJAWMMVSPIE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)C)C(=O)OC)C |
Computed by PubChem (NCBI)