cas: 5344-97-8 — see every product listed under this CAS number, including other names
3,5-Dimethyl-4-nitrophenol 97% (CAS 5344-97-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A211216-250mg |
| cas | 5344-97-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 181.25 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 665.19 Pln | |
| Ambeed | 500g | 2456.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A211216 |
3,5-dimethyl-4-nitrophenol (CAS 5344-97-8) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 3,5-dimethyl-4-nitrophenol. InChIKey: MMLPWOHLKRXZJA-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 3,5-dimethyl-4-nitrophenol |
| InChIKey | MMLPWOHLKRXZJA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1[N+](=O)[O-])C)O |
Computed by PubChem (NCBI)