3,5-Dimethyl-4-nitrophenol, 99%, 99%
cas: 5344-97-8 — see every product listed under this CAS number, including other names
3,5-Dimethyl-4-nitrophenol, 99%, 99% (CAS 5344-97-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DAG6-250mg |
| cas | 5344-97-8 |
| size | 250mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 160.40 Pln | |
| Chemat | 100g | 362.00 Pln | |
| Chemat | 250g | 683.60 Pln | |
| Chemat | 500g | 1262.40 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
3,5-dimethyl-4-nitrophenol (CAS 5344-97-8) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 3,5-dimethyl-4-nitrophenol. InChIKey: MMLPWOHLKRXZJA-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 3,5-dimethyl-4-nitrophenol |
| InChIKey | MMLPWOHLKRXZJA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1[N+](=O)[O-])C)O |
Computed by PubChem (NCBI)