cas: 14248-66-9 — see every product listed under this CAS number, including other names
3,5-Dimethyl-4-nitropyridine 1-oxide 95% (CAS 14248-66-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A552809-1g |
| cas | 14248-66-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 359.25 Pln | |
| Ambeed | 25g | 592.88 Pln | |
| Ambeed | 100g | 1638.62 Pln | |
| Ambeed | 500g | 5988.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A552809 |
3,5-dimethyl-4-nitro-1-oxidopyridin-1-ium (CAS 14248-66-9) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 3,5-dimethyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: VLKVMXPKEDVNBO-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3,5-dimethyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | VLKVMXPKEDVNBO-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=CC(=C1[N+](=O)[O-])C)[O-] |
Computed by PubChem (NCBI)