cas: 14248-66-9 — see every product listed under this CAS number, including other names
3,5-Dimethyl-4-nitropyridine 1-oxide, 95%, 95% (CAS 14248-66-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118ZFN-1g |
| cas | 14248-66-9 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 285.20 Pln | |
| Chemat | 25g | 510.80 Pln | |
| Chemat | 100g | 1413.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,5-dimethyl-4-nitro-1-oxidopyridin-1-ium (CAS 14248-66-9) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 3,5-dimethyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: VLKVMXPKEDVNBO-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3,5-dimethyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | VLKVMXPKEDVNBO-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=CC(=C1[N+](=O)[O-])C)[O-] |
Computed by PubChem (NCBI)