cas: 888-71-1 — see every product listed under this CAS number, including other names
3,5-Diphenyl-1,2,4-oxadiazole, 97%, 97% (CAS 888-71-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119AKW-250mg |
| cas | 888-71-1 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 794.00 Pln | |
| Chemat | 500mg | 1216.40 Pln | |
| Chemat | 1g | 1542.80 Pln | |
| Chemat | 100mg | 486.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,5-diphenyl-1,2,4-oxadiazole (CAS 888-71-1) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 3,5-diphenyl-1,2,4-oxadiazole. InChIKey: VIZNDSYPXQJMCM-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3,5-diphenyl-1,2,4-oxadiazole |
| InChIKey | VIZNDSYPXQJMCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)