cas: 74684-38-1 — see every product listed under this CAS number, including other names
3,5-di-tert-butyl-4-methoxybenzaldehyde, 97%, 97% (CAS 74684-38-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116IFM-100mg |
| cas | 74684-38-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 568.40 Pln | |
| Chemat | 5g | 1576.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,5-ditert-butyl-4-methoxybenzaldehyde (CAS 74684-38-1) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: 3,5-ditert-butyl-4-methoxybenzaldehyde. InChIKey: JTILSNFKCZCROG-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | 3,5-ditert-butyl-4-methoxybenzaldehyde |
| InChIKey | JTILSNFKCZCROG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1OC)C(C)(C)C)C=O |
Computed by PubChem (NCBI)