CAS 22825-00-9 is the registry number for 6,7-Dimethoxy-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dimethoxy-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (CAS 22825-00-9) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: 6,7-dimethoxy-1,1,4,4-tetramethyl-2,3-dihydronaphthalene. InChIKey: PPLDTYXVLXUVSR-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | 6,7-dimethoxy-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| InChIKey | PPLDTYXVLXUVSR-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=CC(=C(C=C21)OC)OC)(C)C)C |
Computed by PubChem (NCBI)