CAS 74684-38-1 appears in our catalog under these names: 3,5-Di-tert-butyl-4-methoxybenzaldehyde, 97%, 3,5–Di–tert–butyl–4–methoxybenzaldehyde, 3,5-Di-tert-butyl-4-methoxybenzaldehyde 97%, 3,5-di-tert-butyl-4-methoxybenzaldehyde, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg.
3,5-ditert-butyl-4-methoxybenzaldehyde (CAS 74684-38-1) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: 3,5-ditert-butyl-4-methoxybenzaldehyde. InChIKey: JTILSNFKCZCROG-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | 3,5-ditert-butyl-4-methoxybenzaldehyde |
| InChIKey | JTILSNFKCZCROG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1OC)C(C)(C)C)C=O |
Computed by PubChem (NCBI)