CAS 64277-87-8 appears in our catalog under these names: 3,5-Di-tert-butylbenzoic acid methyl ester, 95%, Methyl 3,5–Di–tert–butylbenzoate, Methyl 3,5-Di-tert-butylbenzoate, >98.0%(GC), Methyl 3,5-Di-tert-butylbenzoate, 98%, 98%, Methyl 3,5-di-tert-butylbenzoate, 98%(LC-MS),RG. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g.
Methyl 3,5-ditert-butylbenzoate (CAS 64277-87-8) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: methyl 3,5-ditert-butylbenzoate. InChIKey: ZEIOQJMJXFVPOG-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | methyl 3,5-ditert-butylbenzoate |
| InChIKey | ZEIOQJMJXFVPOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C(=O)OC)C(C)(C)C |
Computed by PubChem (NCBI)