cas: 928292-69-7 — see every product listed under this CAS number, including other names
3,6,9,12,15,18,21,24,27,30-Decaoxadotriacontane-1,32-diamine, 97%, 97% (CAS 928292-69-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GV9E-50mg |
| cas | 928292-69-7 |
| size | 50mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 213.20 Pln | |
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 894.80 Pln | |
| Chemat | 5g | 3112.40 Pln | |
| Chemat | 500mg | 578.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 928292-69-7) is a chemical compound with the molecular formula C22H48N2O10 and a molecular weight of 500.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: YMQALIUBVKNYIJ-UHFFFAOYSA-N.
| Molecular formula | C22H48N2O10 |
|---|---|
| Molecular weight | 500.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | YMQALIUBVKNYIJ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)N |
Computed by PubChem (NCBI)